C19H31Cl2N5 — CID 111198246
2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine (PubChem CID 111198246) has the molecular formula C19H31Cl2N5 and a molecular weight of 400.40 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111198246 |
| Molecular Formula | C19H31Cl2N5 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCCCN1CCCN(C)CC1 |
| InChI | InChI=1S/C19H31Cl2N5/c1-3-22-19(24-15-16-6-7-17(20)14-18(16)21)23-8-4-10-26-11-5-9-25(2)12-13-26/h6-7,14H,3-5,8-13,15H2,1-2H3,(H2,22,23,24) |
| InChIKey | ZIIIGQFWRJNTSS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|