C17H27Cl2IN4O — CID 110972268
2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 110972268) has the molecular formula C17H27Cl2IN4O and a molecular weight of 501.24 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110972268 |
| Molecular Formula | C17H27Cl2IN4O |
| Molecular Weight | 501.24 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCCCN1CCOCC1.I |
| InChI | InChI=1S/C17H26Cl2N4O.HI/c1-2-20-17(21-6-3-7-23-8-10-24-11-9-23)22-13-14-4-5-15(18)12-16(14)19;/h4-5,12H,2-3,6-11,13H2,1H3,(H2,20,21,22);1H |
| InChIKey | OCPJZIBYHZWTIX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|