C18H27Cl2N5O — CID 111198108
1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-[(2,4-dichlorophenyl)methyl]-3-ethylguanidine (PubChem CID 111198108) has the molecular formula C18H27Cl2N5O and a molecular weight of 400.35 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-[(2,4-dichlorophenyl)methyl]-3-ethylguanidine.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-[(2,4-dichlorophenyl)methyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111198108 |
| Molecular Formula | C18H27Cl2N5O |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-[(2,4-dichlorophenyl)methyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCCN1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C18H27Cl2N5O/c1-3-21-18(23-13-15-4-5-16(19)12-17(15)20)22-6-7-24-8-10-25(11-9-24)14(2)26/h4-5,12H,3,6-11,13H2,1-2H3,(H2,21,22,23) |
| InChIKey | ISLYXIUDAUFKNR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|