C16H25Cl2IN4O — CID 111197863
3-[[N'-[(2,4-dichlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide (PubChem CID 111197863) has the molecular formula C16H25Cl2IN4O and a molecular weight of 487.21 g/mol. Its IUPAC name is 3-[[N'-[(2,4-dichlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide.
| Compound Name | 3-[[N'-[(2,4-dichlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111197863 |
| Molecular Formula | C16H25Cl2IN4O |
| Molecular Weight | 487.21 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | 3-[[N'-[(2,4-dichlorophenyl)methyl]-N-ethylcarbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCCC(=O)NC(C)C.I |
| InChI | InChI=1S/C16H24Cl2N4O.HI/c1-4-19-16(20-8-7-15(23)22-11(2)3)21-10-12-5-6-13(17)9-14(12)18;/h5-6,9,11H,4,7-8,10H2,1-3H3,(H,22,23)(H2,19,20,21);1H |
| InChIKey | RDSHSISCWQZYGR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|