C17H26Cl2N4O — CID 111720307
3-[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide (PubChem CID 111720307) has the molecular formula C17H26Cl2N4O and a molecular weight of 373.33 g/mol. Its IUPAC name is 3-[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 111720307 |
| Molecular Formula | C17H26Cl2N4O |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]-N-propan-2-ylpropanamide |
| SMILES | C/N=C(/NCCCc1ccc(Cl)cc1Cl)NCCC(=O)NC(C)C |
| InChI | InChI=1S/C17H26Cl2N4O/c1-12(2)23-16(24)8-10-22-17(20-3)21-9-4-5-13-6-7-14(18)11-15(13)19/h6-7,11-12H,4-5,8-10H2,1-3H3,(H,23,24)(H2,20,21,22) |
| InChIKey | LUYUDXXHFDBUIU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|