C21H27Cl2IN4O — CID 111720553
4-[[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111720553) has the molecular formula C21H27Cl2IN4O and a molecular weight of 549.28 g/mol. Its IUPAC name is 4-[[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111720553 |
| Molecular Formula | C21H27Cl2IN4O |
| Molecular Weight | 549.28 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | 4-[[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | C/N=C(\NCCCc1ccc(Cl)cc1Cl)NCc1ccc(C(=O)N(C)C)cc1.I |
| InChI | InChI=1S/C21H26Cl2N4O.HI/c1-24-21(25-12-4-5-16-10-11-18(22)13-19(16)23)26-14-15-6-8-17(9-7-15)20(28)27(2)3;/h6-11,13H,4-5,12,14H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | GGUNMLWFOKCFPC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.28 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|