C20H23Cl2IN6 — CID 111720378
1-[3-(2,4-dichlorophenyl)propyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111720378) has the molecular formula C20H23Cl2IN6 and a molecular weight of 545.26 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenyl)propyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(2,4-dichlorophenyl)propyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111720378 |
| Molecular Formula | C20H23Cl2IN6 |
| Molecular Weight | 545.26 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | 1-[3-(2,4-dichlorophenyl)propyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1ccc(Cl)cc1Cl)NCc1ccc(-n2cncn2)cc1.I |
| InChI | InChI=1S/C20H22Cl2N6.HI/c1-23-20(25-10-2-3-16-6-7-17(21)11-19(16)22)26-12-15-4-8-18(9-5-15)28-14-24-13-27-28;/h4-9,11,13-14H,2-3,10,12H2,1H3,(H2,23,25,26);1H |
| InChIKey | UEDDKASLHIEKKN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|