C18H18Cl2N6 — CID 111198016
1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine (PubChem CID 111198016) has the molecular formula C18H18Cl2N6 and a molecular weight of 389.29 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111198016 |
| Molecular Formula | C18H18Cl2N6 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(-n2cncn2)cc1)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N6/c1-21-18(24-10-14-4-5-15(19)8-17(14)20)23-9-13-2-6-16(7-3-13)26-12-22-11-25-26/h2-8,11-12H,9-10H2,1H3,(H2,21,23,24) |
| InChIKey | KBYDOFSASJYSAW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|