C21H25N7O — CID 111873549
N,N-dimethyl-4-[[[N'-methyl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111873549) has the molecular formula C21H25N7O and a molecular weight of 391.48 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[N'-methyl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N,N-dimethyl-4-[[[N'-methyl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111873549 |
| Molecular Formula | C21H25N7O |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | N,N-dimethyl-4-[[[N'-methyl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1ccc(C(=O)N(C)C)cc1)NCc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C21H25N7O/c1-22-21(24-12-16-4-8-18(9-5-16)20(29)27(2)3)25-13-17-6-10-19(11-7-17)28-15-23-14-26-28/h4-11,14-15H,12-13H2,1-3H3,(H2,22,24,25) |
| InChIKey | HFLRUFHTDZYCQC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|