C19H22N6S — CID 111373121
2-methyl-1-(2-phenylsulfanylethyl)-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine (PubChem CID 111373121) has the molecular formula C19H22N6S and a molecular weight of 366.49 g/mol. Its IUPAC name is 2-methyl-1-(2-phenylsulfanylethyl)-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(2-phenylsulfanylethyl)-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111373121 |
| Molecular Formula | C19H22N6S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-methyl-1-(2-phenylsulfanylethyl)-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCCSc1ccccc1)NCc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C19H22N6S/c1-20-19(22-11-12-26-18-5-3-2-4-6-18)23-13-16-7-9-17(10-8-16)25-15-21-14-24-25/h2-10,14-15H,11-13H2,1H3,(H2,20,22,23) |
| InChIKey | GLNOPXJGPMLMHR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|