C17H16N4OS — CID 167764922
2-phenylsulfanyl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]acetamide (PubChem CID 167764922) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-phenylsulfanyl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]acetamide.
| Compound Name | 2-phenylsulfanyl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 167764922 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-phenylsulfanyl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]acetamide |
| SMILES | O=C(CSc1ccccc1)NCc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C17H16N4OS/c22-17(11-23-16-4-2-1-3-5-16)19-10-14-6-8-15(9-7-14)21-13-18-12-20-21/h1-9,12-13H,10-11H2,(H,19,22) |
| InChIKey | APZDFTXYRXDEPY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |