C20H25N5O2 — CID 111875269
4-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide (PubChem CID 111875269) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide.
| Compound Name | 4-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111875269 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 4-[[[N-[[4-(dimethylcarbamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1ccc(C(N)=O)cc1)NCc1ccc(C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C20H25N5O2/c1-22-20(23-12-14-4-8-16(9-5-14)18(21)26)24-13-15-6-10-17(11-7-15)19(27)25(2)3/h4-11H,12-13H2,1-3H3,(H2,21,26)(H2,22,23,24) |
| InChIKey | XWKQDONUOVOTQV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|