C19H32IN5O2 — CID 111874982
4-[[[N-[2-(2,2-dimethylpropanoylamino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide (PubChem CID 111874982) has the molecular formula C19H32IN5O2 and a molecular weight of 489.40 g/mol. Its IUPAC name is 4-[[[N-[2-(2,2-dimethylpropanoylamino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide.
| Compound Name | 4-[[[N-[2-(2,2-dimethylpropanoylamino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111874982 |
| Molecular Formula | C19H32IN5O2 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 4-[[[N-[2-(2,2-dimethylpropanoylamino)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylbenzamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)C(C)(C)C)NCc1ccc(C(=O)N(C)C)cc1.I |
| InChI | InChI=1S/C19H31N5O2.HI/c1-19(2,3)17(26)21-11-12-22-18(20-4)23-13-14-7-9-15(10-8-14)16(25)24(5)6;/h7-10H,11-13H2,1-6H3,(H,21,26)(H2,20,22,23);1H |
| InChIKey | VJUPKPZFFQVSRW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|