C20H21Cl2N5 — CID 111197666
1-[(2,4-dichlorophenyl)methyl]-3-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylguanidine (PubChem CID 111197666) has the molecular formula C20H21Cl2N5 and a molecular weight of 402.33 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111197666 |
| Molecular Formula | C20H21Cl2N5 |
| Molecular Weight | 402.33 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(Cn2ccnc2)cc1)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H21Cl2N5/c1-23-20(26-12-17-6-7-18(21)10-19(17)22)25-11-15-2-4-16(5-3-15)13-27-9-8-24-14-27/h2-10,14H,11-13H2,1H3,(H2,23,25,26) |
| InChIKey | FIARVJXLTHQSJN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|