C20H25IN6O — CID 111880792
1-[(2-ethoxyphenyl)methyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111880792) has the molecular formula C20H25IN6O and a molecular weight of 492.37 g/mol. Its IUPAC name is 1-[(2-ethoxyphenyl)methyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-ethoxyphenyl)methyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111880792 |
| Molecular Formula | C20H25IN6O |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 1-[(2-ethoxyphenyl)methyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCOc1ccccc1CN/C(=N\C)NCc1ccc(-n2cncn2)cc1.I |
| InChI | InChI=1S/C20H24N6O.HI/c1-3-27-19-7-5-4-6-17(19)13-24-20(21-2)23-12-16-8-10-18(11-9-16)26-15-22-14-25-26;/h4-11,14-15H,3,12-13H2,1-2H3,(H2,21,23,24);1H |
| InChIKey | NMYLWQHFPFHPSQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|