C21H25IN6O — CID 111556038
2-methyl-1-[(2-prop-2-enoxyphenyl)methyl]-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111556038) has the molecular formula C21H25IN6O and a molecular weight of 504.38 g/mol. Its IUPAC name is 2-methyl-1-[(2-prop-2-enoxyphenyl)methyl]-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-prop-2-enoxyphenyl)methyl]-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111556038 |
| Molecular Formula | C21H25IN6O |
| Molecular Weight | 504.38 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 2-methyl-1-[(2-prop-2-enoxyphenyl)methyl]-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C=CCOc1ccccc1CN/C(=N\C)NCc1ccc(-n2cncn2)cc1.I |
| InChI | InChI=1S/C21H24N6O.HI/c1-3-12-28-20-7-5-4-6-18(20)14-25-21(22-2)24-13-17-8-10-19(11-9-17)27-16-23-15-26-27;/h3-11,15-16H,1,12-14H2,2H3,(H2,22,24,25);1H |
| InChIKey | NXGHFPNBIVZWLK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|