C16H24Cl2IN3O2 — CID 111720254
methyl 3-[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide (PubChem CID 111720254) has the molecular formula C16H24Cl2IN3O2 and a molecular weight of 488.20 g/mol. Its IUPAC name is methyl 3-[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide.
| Compound Name | methyl 3-[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide |
|---|---|
| PubChem CID | 111720254 |
| Molecular Formula | C16H24Cl2IN3O2 |
| Molecular Weight | 488.20 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | methyl 3-[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide |
| SMILES | C/N=C(/NCCCc1ccc(Cl)cc1Cl)NCC(C)C(=O)OC.I |
| InChI | InChI=1S/C16H23Cl2N3O2.HI/c1-11(15(22)23-3)10-21-16(19-2)20-8-4-5-12-6-7-13(17)9-14(12)18;/h6-7,9,11H,4-5,8,10H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | OGMRXJFWKCQDAM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|