C17H28Cl2IN3O — CID 111720487
1-[3-(2,4-dichlorophenyl)propyl]-3-(4-ethoxybutyl)-2-methylguanidine;hydroiodide (PubChem CID 111720487) has the molecular formula C17H28Cl2IN3O and a molecular weight of 488.24 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenyl)propyl]-3-(4-ethoxybutyl)-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(2,4-dichlorophenyl)propyl]-3-(4-ethoxybutyl)-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111720487 |
| Molecular Formula | C17H28Cl2IN3O |
| Molecular Weight | 488.24 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 1-[3-(2,4-dichlorophenyl)propyl]-3-(4-ethoxybutyl)-2-methylguanidine;hydroiodide |
| SMILES | CCOCCCCN/C(=N\C)NCCCc1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C17H27Cl2N3O.HI/c1-3-23-12-5-4-10-21-17(20-2)22-11-6-7-14-8-9-15(18)13-16(14)19;/h8-9,13H,3-7,10-12H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | GKPVDUWAHJTTKF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.24 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|