C17H26Cl2IN3O2 — CID 111720533
methyl 5-[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]pentanoate;hydroiodide (PubChem CID 111720533) has the molecular formula C17H26Cl2IN3O2 and a molecular weight of 502.22 g/mol. Its IUPAC name is methyl 5-[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]pentanoate;hydroiodide.
| Compound Name | methyl 5-[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 111720533 |
| Molecular Formula | C17H26Cl2IN3O2 |
| Molecular Weight | 502.22 g/mol |
| Exact Mass | 501.04 |
| IUPAC Name | methyl 5-[[N-[3-(2,4-dichlorophenyl)propyl]-N'-methylcarbamimidoyl]amino]pentanoate;hydroiodide |
| SMILES | C/N=C(\NCCCCC(=O)OC)NCCCc1ccc(Cl)cc1Cl.I |
| InChI | InChI=1S/C17H25Cl2N3O2.HI/c1-20-17(21-10-4-3-7-16(23)24-2)22-11-5-6-13-8-9-14(18)12-15(13)19;/h8-9,12H,3-7,10-11H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | VKKZJAFTDKNFIQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|