C19H24Cl2N4O2S — CID 111720430
1-[3-(2,4-dichlorophenyl)propyl]-2-methyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine (PubChem CID 111720430) has the molecular formula C19H24Cl2N4O2S and a molecular weight of 443.40 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenyl)propyl]-2-methyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine.
| Compound Name | 1-[3-(2,4-dichlorophenyl)propyl]-2-methyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111720430 |
| Molecular Formula | C19H24Cl2N4O2S |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 1-[3-(2,4-dichlorophenyl)propyl]-2-methyl-3-[2-(4-sulfamoylphenyl)ethyl]guanidine |
| SMILES | C/N=C(\NCCCc1ccc(Cl)cc1Cl)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H24Cl2N4O2S/c1-23-19(24-11-2-3-15-6-7-16(20)13-18(15)21)25-12-10-14-4-8-17(9-5-14)28(22,26)27/h4-9,13H,2-3,10-12H2,1H3,(H2,22,26,27)(H2,23,24,25) |
| InChIKey | LGBOZIPKKQACGM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|