C16H16Cl2N2O3S — CID 110293779
2,4-dichloro-N-[3-(4-sulfamoylphenyl)propyl]benzamide (PubChem CID 110293779) has the molecular formula C16H16Cl2N2O3S and a molecular weight of 387.29 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-(4-sulfamoylphenyl)propyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-(4-sulfamoylphenyl)propyl]benzamide |
|---|---|
| PubChem CID | 110293779 |
| Molecular Formula | C16H16Cl2N2O3S |
| Molecular Weight | 387.29 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 2,4-dichloro-N-[3-(4-sulfamoylphenyl)propyl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(CCCNC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2N2O3S/c17-12-5-8-14(15(18)10-12)16(21)20-9-1-2-11-3-6-13(7-4-11)24(19,22)23/h3-8,10H,1-2,9H2,(H,20,21)(H2,19,22,23) |
| InChIKey | XYQUZNDPRAPWOQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|