C16H13Cl3N2O2 — CID 46433349
2,4-dichloro-N-[2-[(2-chlorobenzoyl)amino]ethyl]benzamide (PubChem CID 46433349) has the molecular formula C16H13Cl3N2O2 and a molecular weight of 371.65 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[(2-chlorobenzoyl)amino]ethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[(2-chlorobenzoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 46433349 |
| Molecular Formula | C16H13Cl3N2O2 |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 2,4-dichloro-N-[2-[(2-chlorobenzoyl)amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(Cl)cc1Cl)c1ccccc1Cl |
| InChI | InChI=1S/C16H13Cl3N2O2/c17-10-5-6-12(14(19)9-10)16(23)21-8-7-20-15(22)11-3-1-2-4-13(11)18/h1-6,9H,7-8H2,(H,20,22)(H,21,23) |
| InChIKey | PNSGBQSTDDDFAA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|