C14H9Cl3FNO — CID 23019893
2,4-dichloro-N-[(2-chloro-6-fluorophenyl)methyl]benzamide (PubChem CID 23019893) has the molecular formula C14H9Cl3FNO and a molecular weight of 332.59 g/mol. Its IUPAC name is 2,4-dichloro-N-[(2-chloro-6-fluorophenyl)methyl]benzamide.
| Compound Name | 2,4-dichloro-N-[(2-chloro-6-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 23019893 |
| Molecular Formula | C14H9Cl3FNO |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 2,4-dichloro-N-[(2-chloro-6-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1c(F)cccc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl3FNO/c15-8-4-5-9(12(17)6-8)14(20)19-7-10-11(16)2-1-3-13(10)18/h1-6H,7H2,(H,19,20) |
| InChIKey | FXUHXIWVKIVYEE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |