C9H9ClFNO2 — CID 82127264
N-[(2-chloro-6-fluorophenyl)methyl]-2-hydroxyacetamide (PubChem CID 82127264) has the molecular formula C9H9ClFNO2 and a molecular weight of 217.63 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-2-hydroxyacetamide.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 82127264 |
| Molecular Formula | C9H9ClFNO2 |
| Molecular Weight | 217.63 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-2-hydroxyacetamide |
| SMILES | O=C(CO)NCc1c(F)cccc1Cl |
| InChI | InChI=1S/C9H9ClFNO2/c10-7-2-1-3-8(11)6(7)4-12-9(14)5-13/h1-3,13H,4-5H2,(H,12,14) |
| InChIKey | OLWMBZGWGZCVEO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.63 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |