C8H7Cl2NO2 — CID 77230594
(2,6-dichlorophenyl)methylcarbamic acid (PubChem CID 77230594) has the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methylcarbamic acid.
| Compound Name | (2,6-dichlorophenyl)methylcarbamic acid |
|---|---|
| PubChem CID | 77230594 |
| Molecular Formula | C8H7Cl2NO2 |
| Molecular Weight | 220.05 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | (2,6-dichlorophenyl)methylcarbamic acid |
| SMILES | O=C(O)NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C8H7Cl2NO2/c9-6-2-1-3-7(10)5(6)4-11-8(12)13/h1-3,11H,4H2,(H,12,13) |
| InChIKey | BXVLHHMQVCBEEW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.05 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |