C15H12Cl3NO — CID 2679601
N-[(2-chlorophenyl)methyl]-2-(2,6-dichlorophenyl)acetamide (PubChem CID 2679601) has the molecular formula C15H12Cl3NO and a molecular weight of 328.63 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-(2,6-dichlorophenyl)acetamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 2679601 |
| Molecular Formula | C15H12Cl3NO |
| Molecular Weight | 328.63 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-(2,6-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)NCc1ccccc1Cl |
| InChI | InChI=1S/C15H12Cl3NO/c16-12-5-2-1-4-10(12)9-19-15(20)8-11-13(17)6-3-7-14(11)18/h1-7H,8-9H2,(H,19,20) |
| InChIKey | NRXZCBCOPCSDCZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |