C11H10Cl3NO — CID 115636770
N-(2-chloroprop-2-enyl)-2-(2,6-dichlorophenyl)acetamide (PubChem CID 115636770) has the molecular formula C11H10Cl3NO and a molecular weight of 278.57 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-2-(2,6-dichlorophenyl)acetamide.
| Compound Name | N-(2-chloroprop-2-enyl)-2-(2,6-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 115636770 |
| Molecular Formula | C11H10Cl3NO |
| Molecular Weight | 278.57 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-2-(2,6-dichlorophenyl)acetamide |
| SMILES | C=C(Cl)CNC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H10Cl3NO/c1-7(12)6-15-11(16)5-8-9(13)3-2-4-10(8)14/h2-4H,1,5-6H2,(H,15,16) |
| InChIKey | LEVRRIODURYDFI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.57 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |