C11H11Cl2NO4 — CID 66166034
3-[[2-(2,6-dichlorophenyl)acetyl]amino]-2-hydroxypropanoic acid (PubChem CID 66166034) has the molecular formula C11H11Cl2NO4 and a molecular weight of 292.12 g/mol. Its IUPAC name is 3-[[2-(2,6-dichlorophenyl)acetyl]amino]-2-hydroxypropanoic acid.
| Compound Name | 3-[[2-(2,6-dichlorophenyl)acetyl]amino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 66166034 |
| Molecular Formula | C11H11Cl2NO4 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 3-[[2-(2,6-dichlorophenyl)acetyl]amino]-2-hydroxypropanoic acid |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)NCC(O)C(=O)O |
| InChI | InChI=1S/C11H11Cl2NO4/c12-7-2-1-3-8(13)6(7)4-10(16)14-5-9(15)11(17)18/h1-3,9,15H,4-5H2,(H,14,16)(H,17,18) |
| InChIKey | ZBCWBYXCLZNLHE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |