C15H20Cl2N2O3 — CID 110880574
2-(2,6-dichlorophenyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)acetamide (PubChem CID 110880574) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 110880574 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-(2-hydroxy-3-morpholin-4-ylpropyl)acetamide |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)NCC(O)CN1CCOCC1 |
| InChI | InChI=1S/C15H20Cl2N2O3/c16-13-2-1-3-14(17)12(13)8-15(21)18-9-11(20)10-19-4-6-22-7-5-19/h1-3,11,20H,4-10H2,(H,18,21) |
| InChIKey | SBFYKEVJZZEBAW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |