C17H24Cl2N2O2 — CID 55520442
2-(2,6-dichlorophenyl)-N-(3-methyl-2-morpholin-4-ylbutyl)acetamide (PubChem CID 55520442) has the molecular formula C17H24Cl2N2O2 and a molecular weight of 359.30 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-N-(3-methyl-2-morpholin-4-ylbutyl)acetamide.
| Compound Name | 2-(2,6-dichlorophenyl)-N-(3-methyl-2-morpholin-4-ylbutyl)acetamide |
|---|---|
| PubChem CID | 55520442 |
| Molecular Formula | C17H24Cl2N2O2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-N-(3-methyl-2-morpholin-4-ylbutyl)acetamide |
| SMILES | CC(C)C(CNC(=O)Cc1c(Cl)cccc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C17H24Cl2N2O2/c1-12(2)16(21-6-8-23-9-7-21)11-20-17(22)10-13-14(18)4-3-5-15(13)19/h3-5,12,16H,6-11H2,1-2H3,(H,20,22) |
| InChIKey | GIRYPSNOWWWNJZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |