C18H26N4O5 — CID 55519085
N-[2-[(3-methyl-2-morpholin-4-ylbutyl)amino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 55519085) has the molecular formula C18H26N4O5 and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[2-[(3-methyl-2-morpholin-4-ylbutyl)amino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[(3-methyl-2-morpholin-4-ylbutyl)amino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55519085 |
| Molecular Formula | C18H26N4O5 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | N-[2-[(3-methyl-2-morpholin-4-ylbutyl)amino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | CC(C)C(CNC(=O)CNC(=O)c1cccc([N+](=O)[O-])c1)N1CCOCC1 |
| InChI | InChI=1S/C18H26N4O5/c1-13(2)16(21-6-8-27-9-7-21)11-19-17(23)12-20-18(24)14-4-3-5-15(10-14)22(25)26/h3-5,10,13,16H,6-9,11-12H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | ROQDVYQAAMRULM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|