C20H30ClN3O3 — CID 55550745
3-chloro-N-[2-[(3-ethyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]benzamide (PubChem CID 55550745) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is 3-chloro-N-[2-[(3-ethyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]benzamide.
| Compound Name | 3-chloro-N-[2-[(3-ethyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55550745 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 3-chloro-N-[2-[(3-ethyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]benzamide |
| SMILES | CCC(CC)C(CNC(=O)CNC(=O)c1cccc(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C20H30ClN3O3/c1-3-15(4-2)18(24-8-10-27-11-9-24)13-22-19(25)14-23-20(26)16-6-5-7-17(21)12-16/h5-7,12,15,18H,3-4,8-11,13-14H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | YYNOIYRDPROIEC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |