C23H33N3O2 — CID 46408746
N-(3-ethyl-2-morpholin-4-ylpentyl)-2-(4-pyrrol-1-ylphenyl)acetamide (PubChem CID 46408746) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-(3-ethyl-2-morpholin-4-ylpentyl)-2-(4-pyrrol-1-ylphenyl)acetamide.
| Compound Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-2-(4-pyrrol-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 46408746 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N-(3-ethyl-2-morpholin-4-ylpentyl)-2-(4-pyrrol-1-ylphenyl)acetamide |
| SMILES | CCC(CC)C(CNC(=O)Cc1ccc(-n2cccc2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C23H33N3O2/c1-3-20(4-2)22(26-13-15-28-16-14-26)18-24-23(27)17-19-7-9-21(10-8-19)25-11-5-6-12-25/h5-12,20,22H,3-4,13-18H2,1-2H3,(H,24,27) |
| InChIKey | VKNQQYHKGVSLGL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |