C19H28BrFN2O2 — CID 60524780
2-(3-bromo-4-fluorophenyl)-N-(3-ethyl-2-morpholin-4-ylpentyl)acetamide (PubChem CID 60524780) has the molecular formula C19H28BrFN2O2 and a molecular weight of 415.35 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-N-(3-ethyl-2-morpholin-4-ylpentyl)acetamide.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-N-(3-ethyl-2-morpholin-4-ylpentyl)acetamide |
|---|---|
| PubChem CID | 60524780 |
| Molecular Formula | C19H28BrFN2O2 |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-N-(3-ethyl-2-morpholin-4-ylpentyl)acetamide |
| SMILES | CCC(CC)C(CNC(=O)Cc1ccc(F)c(Br)c1)N1CCOCC1 |
| InChI | InChI=1S/C19H28BrFN2O2/c1-3-15(4-2)18(23-7-9-25-10-8-23)13-22-19(24)12-14-5-6-17(21)16(20)11-14/h5-6,11,15,18H,3-4,7-10,12-13H2,1-2H3,(H,22,24) |
| InChIKey | OKEFBJRUGUXDPC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |