C20H30F2N2O4S — CID 96534807
4-(difluoromethylsulfonylmethyl)-N-[(2R)-3-ethyl-2-morpholin-4-ylpentyl]benzamide (PubChem CID 96534807) has the molecular formula C20H30F2N2O4S and a molecular weight of 432.53 g/mol. Its IUPAC name is 4-(difluoromethylsulfonylmethyl)-N-[(2R)-3-ethyl-2-morpholin-4-ylpentyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonylmethyl)-N-[(2R)-3-ethyl-2-morpholin-4-ylpentyl]benzamide |
|---|---|
| PubChem CID | 96534807 |
| Molecular Formula | C20H30F2N2O4S |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 4-(difluoromethylsulfonylmethyl)-N-[(2R)-3-ethyl-2-morpholin-4-ylpentyl]benzamide |
| SMILES | CCC(CC)[C@H](CNC(=O)c1ccc(CS(=O)(=O)C(F)F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H30F2N2O4S/c1-3-16(4-2)18(24-9-11-28-12-10-24)13-23-19(25)17-7-5-15(6-8-17)14-29(26,27)20(21)22/h5-8,16,18,20H,3-4,9-14H2,1-2H3,(H,23,25)/t18-/m0/s1 |
| InChIKey | ISYUKOAQSKVSSN-SFHVURJKSA-N |
| XLogP | 2.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |