C21H28ClN3O2 — CID 55731335
2-chloro-N-(3-ethyl-2-morpholin-4-ylpentyl)quinoline-6-carboxamide (PubChem CID 55731335) has the molecular formula C21H28ClN3O2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 2-chloro-N-(3-ethyl-2-morpholin-4-ylpentyl)quinoline-6-carboxamide.
| Compound Name | 2-chloro-N-(3-ethyl-2-morpholin-4-ylpentyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 55731335 |
| Molecular Formula | C21H28ClN3O2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-chloro-N-(3-ethyl-2-morpholin-4-ylpentyl)quinoline-6-carboxamide |
| SMILES | CCC(CC)C(CNC(=O)c1ccc2nc(Cl)ccc2c1)N1CCOCC1 |
| InChI | InChI=1S/C21H28ClN3O2/c1-3-15(4-2)19(25-9-11-27-12-10-25)14-23-21(26)17-5-7-18-16(13-17)6-8-20(22)24-18/h5-8,13,15,19H,3-4,9-12,14H2,1-2H3,(H,23,26) |
| InChIKey | NWBHECJPTUKNNT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|