C20H30F2N2O4 — CID 43046344
4-(difluoromethoxy)-N-(3-ethyl-2-morpholin-4-ylpentyl)-3-methoxybenzamide (PubChem CID 43046344) has the molecular formula C20H30F2N2O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(3-ethyl-2-morpholin-4-ylpentyl)-3-methoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-(3-ethyl-2-morpholin-4-ylpentyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 43046344 |
| Molecular Formula | C20H30F2N2O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 4-(difluoromethoxy)-N-(3-ethyl-2-morpholin-4-ylpentyl)-3-methoxybenzamide |
| SMILES | CCC(CC)C(CNC(=O)c1ccc(OC(F)F)c(OC)c1)N1CCOCC1 |
| InChI | InChI=1S/C20H30F2N2O4/c1-4-14(5-2)16(24-8-10-27-11-9-24)13-23-19(25)15-6-7-17(28-20(21)22)18(12-15)26-3/h6-7,12,14,16,20H,4-5,8-11,13H2,1-3H3,(H,23,25) |
| InChIKey | VJXLONVSUFKAJL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |