C14H20F2N2O3 — CID 120654617
4-(difluoromethoxy)-N-[(2R)-2-(ethylamino)propyl]-3-methoxybenzamide (PubChem CID 120654617) has the molecular formula C14H20F2N2O3 and a molecular weight of 302.32 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[(2R)-2-(ethylamino)propyl]-3-methoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[(2R)-2-(ethylamino)propyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 120654617 |
| Molecular Formula | C14H20F2N2O3 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-(difluoromethoxy)-N-[(2R)-2-(ethylamino)propyl]-3-methoxybenzamide |
| SMILES | CCN[C@H](C)CNC(=O)c1ccc(OC(F)F)c(OC)c1 |
| InChI | InChI=1S/C14H20F2N2O3/c1-4-17-9(2)8-18-13(19)10-5-6-11(21-14(15)16)12(7-10)20-3/h5-7,9,14,17H,4,8H2,1-3H3,(H,18,19)/t9-/m1/s1 |
| InChIKey | PDRATQQLWZBBIW-SECBINFHSA-N |
| XLogP | 2.02 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |