C16H22F2N2O4 — CID 35515205
4-(difluoromethoxy)-3-methoxy-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide (PubChem CID 35515205) has the molecular formula C16H22F2N2O4 and a molecular weight of 344.36 g/mol. Its IUPAC name is 4-(difluoromethoxy)-3-methoxy-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-3-methoxy-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 35515205 |
| Molecular Formula | C16H22F2N2O4 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-(difluoromethoxy)-3-methoxy-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NCCC(C)C)ccc1OC(F)F |
| InChI | InChI=1S/C16H22F2N2O4/c1-10(2)6-7-19-14(21)9-20-15(22)11-4-5-12(24-16(17)18)13(8-11)23-3/h4-5,8,10,16H,6-7,9H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | RJGWYTDTBGCPAO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |