C17H25F2N3O6S — CID 55693685
4-(difluoromethoxy)-N-[2-[3-[ethylsulfonyl(methyl)amino]propylamino]-2-oxoethyl]-3-methoxybenzamide (PubChem CID 55693685) has the molecular formula C17H25F2N3O6S and a molecular weight of 437.47 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-[2-[3-[ethylsulfonyl(methyl)amino]propylamino]-2-oxoethyl]-3-methoxybenzamide.
| Compound Name | 4-(difluoromethoxy)-N-[2-[3-[ethylsulfonyl(methyl)amino]propylamino]-2-oxoethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 55693685 |
| Molecular Formula | C17H25F2N3O6S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 4-(difluoromethoxy)-N-[2-[3-[ethylsulfonyl(methyl)amino]propylamino]-2-oxoethyl]-3-methoxybenzamide |
| SMILES | CCS(=O)(=O)N(C)CCCNC(=O)CNC(=O)c1ccc(OC(F)F)c(OC)c1 |
| InChI | InChI=1S/C17H25F2N3O6S/c1-4-29(25,26)22(2)9-5-8-20-15(23)11-21-16(24)12-6-7-13(28-17(18)19)14(10-12)27-3/h6-7,10,17H,4-5,8-9,11H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | UQYICXAYQAROEI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|