C18H24F2N2O4 — CID 9217777
N-[2-(cycloheptylamino)-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide (PubChem CID 9217777) has the molecular formula C18H24F2N2O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide.
| Compound Name | N-[2-(cycloheptylamino)-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide |
|---|---|
| PubChem CID | 9217777 |
| Molecular Formula | C18H24F2N2O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-[2-(cycloheptylamino)-2-oxoethyl]-4-(difluoromethoxy)-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NC2CCCCCC2)ccc1OC(F)F |
| InChI | InChI=1S/C18H24F2N2O4/c1-25-15-10-12(8-9-14(15)26-18(19)20)17(24)21-11-16(23)22-13-6-4-2-3-5-7-13/h8-10,13,18H,2-7,11H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | NGQRFVFQDSZQEN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |