C16H19F2NO5 — CID 2607084
[2-(cyclopentylamino)-2-oxoethyl] 4-(difluoromethoxy)-3-methoxybenzoate (PubChem CID 2607084) has the molecular formula C16H19F2NO5 and a molecular weight of 343.33 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 4-(difluoromethoxy)-3-methoxybenzoate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 4-(difluoromethoxy)-3-methoxybenzoate |
|---|---|
| PubChem CID | 2607084 |
| Molecular Formula | C16H19F2NO5 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 4-(difluoromethoxy)-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCC(=O)NC2CCCC2)ccc1OC(F)F |
| InChI | InChI=1S/C16H19F2NO5/c1-22-13-8-10(6-7-12(13)24-16(17)18)15(21)23-9-14(20)19-11-4-2-3-5-11/h6-8,11,16H,2-5,9H2,1H3,(H,19,20) |
| InChIKey | NVZDKMYKLYTTMC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |