C13H16N2O4 — CID 79601075
N-[2-(cyclopropylamino)-2-oxoethyl]-3-hydroxy-4-methoxybenzamide (PubChem CID 79601075) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is N-[2-(cyclopropylamino)-2-oxoethyl]-3-hydroxy-4-methoxybenzamide.
| Compound Name | N-[2-(cyclopropylamino)-2-oxoethyl]-3-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 79601075 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-[2-(cyclopropylamino)-2-oxoethyl]-3-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)NC2CC2)cc1O |
| InChI | InChI=1S/C13H16N2O4/c1-19-11-5-2-8(6-10(11)16)13(18)14-7-12(17)15-9-3-4-9/h2,5-6,9,16H,3-4,7H2,1H3,(H,14,18)(H,15,17) |
| InChIKey | WNOWNHAWDNAJDF-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |