C14H19NO4 — CID 103099443
3-hydroxy-4-methoxy-N-(3-methoxycyclopentyl)benzamide (PubChem CID 103099443) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-hydroxy-4-methoxy-N-(3-methoxycyclopentyl)benzamide.
| Compound Name | 3-hydroxy-4-methoxy-N-(3-methoxycyclopentyl)benzamide |
|---|---|
| PubChem CID | 103099443 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 3-hydroxy-4-methoxy-N-(3-methoxycyclopentyl)benzamide |
| SMILES | COc1ccc(C(=O)NC2CCC(OC)C2)cc1O |
| InChI | InChI=1S/C14H19NO4/c1-18-11-5-4-10(8-11)15-14(17)9-3-6-13(19-2)12(16)7-9/h3,6-7,10-11,16H,4-5,8H2,1-2H3,(H,15,17) |
| InChIKey | PRNLVKBRRRFXPB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |