C15H22ClNO3 — CID 67897205
N-cyclohexyl-3,4-dimethoxybenzamide;hydrochloride (PubChem CID 67897205) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is N-cyclohexyl-3,4-dimethoxybenzamide;hydrochloride.
| Compound Name | N-cyclohexyl-3,4-dimethoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 67897205 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-cyclohexyl-3,4-dimethoxybenzamide;hydrochloride |
| SMILES | COc1ccc(C(=O)NC2CCCCC2)cc1OC.Cl |
| InChI | InChI=1S/C15H21NO3.ClH/c1-18-13-9-8-11(10-14(13)19-2)15(17)16-12-6-4-3-5-7-12;/h8-10,12H,3-7H2,1-2H3,(H,16,17);1H |
| InChIKey | AVBZLWVXJINQKX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |