C18H27NO4 — CID 679003
N-cyclooctyl-3,4,5-trimethoxybenzamide (PubChem CID 679003) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-cyclooctyl-3,4,5-trimethoxybenzamide.
| Compound Name | N-cyclooctyl-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 679003 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-cyclooctyl-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC2CCCCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C18H27NO4/c1-21-15-11-13(12-16(22-2)17(15)23-3)18(20)19-14-9-7-5-4-6-8-10-14/h11-12,14H,4-10H2,1-3H3,(H,19,20) |
| InChIKey | NUFZQANTKYVCON-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |