C17H25N3O5 — CID 1358989
1-cyclohexyl-3-[(3,4,5-trimethoxybenzoyl)amino]urea (PubChem CID 1358989) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(3,4,5-trimethoxybenzoyl)amino]urea.
| Compound Name | 1-cyclohexyl-3-[(3,4,5-trimethoxybenzoyl)amino]urea |
|---|---|
| PubChem CID | 1358989 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-cyclohexyl-3-[(3,4,5-trimethoxybenzoyl)amino]urea |
| SMILES | COc1cc(C(=O)NNC(=O)NC2CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C17H25N3O5/c1-23-13-9-11(10-14(24-2)15(13)25-3)16(21)19-20-17(22)18-12-7-5-4-6-8-12/h9-10,12H,4-8H2,1-3H3,(H,19,21)(H2,18,20,22) |
| InChIKey | MXICDJDHVDPZKA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|