C22H32N2O5 — CID 108549277
N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3,4,5-trimethoxybenzamide (PubChem CID 108549277) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 108549277 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC2CCN(C(=O)C3CCCCC3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H32N2O5/c1-27-18-13-16(14-19(28-2)20(18)29-3)21(25)23-17-9-11-24(12-10-17)22(26)15-7-5-4-6-8-15/h13-15,17H,4-12H2,1-3H3,(H,23,25) |
| InChIKey | BEYMIQYCEWUVOX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |