C22H32N2O4 — CID 55691105
N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 55691105) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 55691105 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NC2CCN(C(=O)C3CCCCC3)CC2)cc1OC |
| InChI | InChI=1S/C22H32N2O4/c1-27-19-9-8-16(14-20(19)28-2)15-21(25)23-18-10-12-24(13-11-18)22(26)17-6-4-3-5-7-17/h8-9,14,17-18H,3-7,10-13,15H2,1-2H3,(H,23,25) |
| InChIKey | ZHKDBVUFFTUHAR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |