C20H28N2O5 — CID 108558758
2-(3,4-dimethoxyphenyl)-N-[1-(oxolane-2-carbonyl)piperidin-4-yl]acetamide (PubChem CID 108558758) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[1-(oxolane-2-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[1-(oxolane-2-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108558758 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[1-(oxolane-2-carbonyl)piperidin-4-yl]acetamide |
| SMILES | COc1ccc(CC(=O)NC2CCN(C(=O)C3CCCO3)CC2)cc1OC |
| InChI | InChI=1S/C20H28N2O5/c1-25-16-6-5-14(12-18(16)26-2)13-19(23)21-15-7-9-22(10-8-15)20(24)17-4-3-11-27-17/h5-6,12,15,17H,3-4,7-11,13H2,1-2H3,(H,21,23) |
| InChIKey | QQYPPXQASQNKPM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |